C20H20N2O2S — CID 134801349
N-prop-2-ynyl-1-(4-thiophen-2-ylbenzoyl)piperidine-4-carboxamide (PubChem CID 134801349) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-prop-2-ynyl-1-(4-thiophen-2-ylbenzoyl)piperidine-4-carboxamide.
| Compound Name | N-prop-2-ynyl-1-(4-thiophen-2-ylbenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134801349 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-prop-2-ynyl-1-(4-thiophen-2-ylbenzoyl)piperidine-4-carboxamide |
| SMILES | C#CCNC(=O)C1CCN(C(=O)c2ccc(-c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C20H20N2O2S/c1-2-11-21-19(23)16-9-12-22(13-10-16)20(24)17-7-5-15(6-8-17)18-4-3-14-25-18/h1,3-8,14,16H,9-13H2,(H,21,23) |
| InChIKey | HTTPPHBZKDAKOA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|