C19H22N6O2S — CID 134801555
CID 134801555 (PubChem CID 134801555) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol.
| Compound Name | CID 134801555 |
|---|---|
| PubChem CID | 134801555 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(NC1CCCN(c2ccc3nnc(C4CC4)n3n2)C1)c1ccccc1 |
| InChI | InChI=1S/C19H22N6O2S/c26-28(27,16-6-2-1-3-7-16)23-15-5-4-12-24(13-15)18-11-10-17-20-21-19(14-8-9-14)25(17)22-18/h1-3,6-7,10-11,14-15H,4-5,8-9,12-13H2,(H-,23,26,27) |
| InChIKey | WHGGYOQSPZELDI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|