C18H22N6O2S — CID 134801667
CID 134801667 (PubChem CID 134801667) has the molecular formula C18H22N6O2S and a molecular weight of 386.48 g/mol.
| Compound Name | CID 134801667 |
|---|---|
| PubChem CID | 134801667 |
| Molecular Formula | C18H22N6O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | — |
| SMILES | Cc1ccc([S+](=O)([O-])NC2CCN(c3ccc4nnc(C)n4n3)CC2)cc1 |
| InChI | InChI=1S/C18H22N6O2S/c1-13-3-5-16(6-4-13)27(25,26)22-15-9-11-23(12-10-15)18-8-7-17-20-19-14(2)24(17)21-18/h3-8,15H,9-12H2,1-2H3,(H-,22,25,26) |
| InChIKey | GXKPWSNHTOKVED-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|