C17H13Cl2N5O — CID 134802321
N-(cyanomethyl)-6-(3,5-dichlorophenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 134802321) has the molecular formula C17H13Cl2N5O and a molecular weight of 374.23 g/mol. Its IUPAC name is N-(cyanomethyl)-6-(3,5-dichlorophenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(cyanomethyl)-6-(3,5-dichlorophenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 134802321 |
| Molecular Formula | C17H13Cl2N5O |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | N-(cyanomethyl)-6-(3,5-dichlorophenyl)-N,1-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CN(CC#N)C(=O)c1cc(-c2cc(Cl)cc(Cl)c2)nc2c1cnn2C |
| InChI | InChI=1S/C17H13Cl2N5O/c1-23(4-3-20)17(25)13-8-15(10-5-11(18)7-12(19)6-10)22-16-14(13)9-21-24(16)2/h5-9H,4H2,1-2H3 |
| InChIKey | URYAGEPMDGGJJG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|