C25H33N3O2 — CID 134802563
1-cyclopentyl-3-[1-[[4-(3-methoxyphenyl)phenyl]methyl]piperidin-3-yl]urea (PubChem CID 134802563) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-cyclopentyl-3-[1-[[4-(3-methoxyphenyl)phenyl]methyl]piperidin-3-yl]urea.
| Compound Name | 1-cyclopentyl-3-[1-[[4-(3-methoxyphenyl)phenyl]methyl]piperidin-3-yl]urea |
|---|---|
| PubChem CID | 134802563 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-cyclopentyl-3-[1-[[4-(3-methoxyphenyl)phenyl]methyl]piperidin-3-yl]urea |
| SMILES | COc1cccc(-c2ccc(CN3CCCC(NC(=O)NC4CCCC4)C3)cc2)c1 |
| InChI | InChI=1S/C25H33N3O2/c1-30-24-10-4-6-21(16-24)20-13-11-19(12-14-20)17-28-15-5-9-23(18-28)27-25(29)26-22-7-2-3-8-22/h4,6,10-14,16,22-23H,2-3,5,7-9,15,17-18H2,1H3,(H2,26,27,29) |
| InChIKey | XMNJMTUZBHCIPN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |