C27H27F3N2O2 — CID 134803410
N-[1-[[3-(2-methoxyphenyl)phenyl]methyl]piperidin-4-yl]-4-(trifluoromethyl)benzamide (PubChem CID 134803410) has the molecular formula C27H27F3N2O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is N-[1-[[3-(2-methoxyphenyl)phenyl]methyl]piperidin-4-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[[3-(2-methoxyphenyl)phenyl]methyl]piperidin-4-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 134803410 |
| Molecular Formula | C27H27F3N2O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-[1-[[3-(2-methoxyphenyl)phenyl]methyl]piperidin-4-yl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccccc1-c1cccc(CN2CCC(NC(=O)c3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C27H27F3N2O2/c1-34-25-8-3-2-7-24(25)21-6-4-5-19(17-21)18-32-15-13-23(14-16-32)31-26(33)20-9-11-22(12-10-20)27(28,29)30/h2-12,17,23H,13-16,18H2,1H3,(H,31,33) |
| InChIKey | YVAOSCKTSAZRPF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |