C20H20N4O3S — CID 134803616
CID 134803616 (PubChem CID 134803616) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol.
| Compound Name | CID 134803616 |
|---|---|
| PubChem CID | 134803616 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | — |
| SMILES | Cc1ccc([S+](=O)([O-])NCCNC(=O)c2ccc(-c3cncnc3)cc2)cc1 |
| InChI | InChI=1S/C20H20N4O3S/c1-15-2-8-19(9-3-15)28(26,27)24-11-10-23-20(25)17-6-4-16(5-7-17)18-12-21-14-22-13-18/h2-9,12-14H,10-11H2,1H3,(H2-,23,24,25,26,27) |
| InChIKey | HKZOUSRTEBADDU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|