C24H22ClN3O2 — CID 134803976
N-[(3-chlorophenyl)methyl]-1-(3-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 134803976) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-1-(3-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-1-(3-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134803976 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-1-(3-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)C1CCCN1C(=O)c1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C24H22ClN3O2/c25-21-9-1-5-17(13-21)15-27-23(29)22-10-4-12-28(22)24(30)19-7-2-6-18(14-19)20-8-3-11-26-16-20/h1-3,5-9,11,13-14,16,22H,4,10,12,15H2,(H,27,29) |
| InChIKey | RTOZTNSJWFRTLG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |