C25H24ClN3O2 — CID 134797544
N-[2-(4-chlorophenyl)ethyl]-1-(3-pyridin-2-ylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 134797544) has the molecular formula C25H24ClN3O2 and a molecular weight of 433.94 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-1-(3-pyridin-2-ylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-1-(3-pyridin-2-ylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134797544 |
| Molecular Formula | C25H24ClN3O2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-1-(3-pyridin-2-ylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)C1CCCN1C(=O)c1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C25H24ClN3O2/c26-21-11-9-18(10-12-21)13-15-28-24(30)23-8-4-16-29(23)25(31)20-6-3-5-19(17-20)22-7-1-2-14-27-22/h1-3,5-7,9-12,14,17,23H,4,8,13,15-16H2,(H,28,30) |
| InChIKey | PFKVKCVWRYCHEY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |