C21H24ClN3O2 — CID 1468798
(2S)-1-N-benzyl-2-N-[2-(4-chlorophenyl)ethyl]pyrrolidine-1,2-dicarboxamide (PubChem CID 1468798) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.89 g/mol. Its IUPAC name is (2S)-1-N-benzyl-2-N-[2-(4-chlorophenyl)ethyl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-benzyl-2-N-[2-(4-chlorophenyl)ethyl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1468798 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (2S)-1-N-benzyl-2-N-[2-(4-chlorophenyl)ethyl]pyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)[C@@H]1CCCN1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H24ClN3O2/c22-18-10-8-16(9-11-18)12-13-23-20(26)19-7-4-14-25(19)21(27)24-15-17-5-2-1-3-6-17/h1-3,5-6,8-11,19H,4,7,12-15H2,(H,23,26)(H,24,27)/t19-/m0/s1 |
| InChIKey | UDSOXHGEPLYOHL-IBGZPJMESA-N |
| XLogP | 3.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |