C17H22ClN3O4 — CID 67811566
2-[[4-[(4-chlorophenyl)methylamino]-4-oxobutyl]carbamoyl]pyrrolidine-1-carboxylic acid (PubChem CID 67811566) has the molecular formula C17H22ClN3O4 and a molecular weight of 367.83 g/mol. Its IUPAC name is 2-[[4-[(4-chlorophenyl)methylamino]-4-oxobutyl]carbamoyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[[4-[(4-chlorophenyl)methylamino]-4-oxobutyl]carbamoyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67811566 |
| Molecular Formula | C17H22ClN3O4 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[[4-[(4-chlorophenyl)methylamino]-4-oxobutyl]carbamoyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(CCCNC(=O)C1CCCN1C(=O)O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClN3O4/c18-13-7-5-12(6-8-13)11-20-15(22)4-1-9-19-16(23)14-3-2-10-21(14)17(24)25/h5-8,14H,1-4,9-11H2,(H,19,23)(H,20,22)(H,24,25) |
| InChIKey | QBVUEEUOPSVREI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|