C21H24Cl2N2O2 — CID 146358188
1-[(2E,4E)-5-chloro-2-ethylhepta-2,4,6-trienoyl]-N-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 146358188) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 1-[(2E,4E)-5-chloro-2-ethylhepta-2,4,6-trienoyl]-N-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2E,4E)-5-chloro-2-ethylhepta-2,4,6-trienoyl]-N-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146358188 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-[(2E,4E)-5-chloro-2-ethylhepta-2,4,6-trienoyl]-N-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | C=C/C(Cl)=C\C=C(/CC)C(=O)N1CCCC1C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-3-16(9-12-17(22)4-2)21(27)25-13-5-6-19(25)20(26)24-14-15-7-10-18(23)11-8-15/h4,7-12,19H,2-3,5-6,13-14H2,1H3,(H,24,26)/b16-9+,17-12+ |
| InChIKey | ICXWLFBCEOXKKH-OILUWJOSSA-N |
| XLogP | 4.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|