C17H19ClN4O2 — CID 123556017
N-[(4-chlorophenyl)methyl]-1-[2-(1H-imidazol-5-yl)acetyl]pyrrolidine-2-carboxamide (PubChem CID 123556017) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-[2-(1H-imidazol-5-yl)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-[2-(1H-imidazol-5-yl)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123556017 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-[2-(1H-imidazol-5-yl)acetyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1CCCN1C(=O)Cc1cnc[nH]1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-13-5-3-12(4-6-13)9-20-17(24)15-2-1-7-22(15)16(23)8-14-10-19-11-21-14/h3-6,10-11,15H,1-2,7-9H2,(H,19,21)(H,20,24) |
| InChIKey | WZHNEDOBTQRATQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |