C17H16F3N3O2 — CID 134804920
N-(2-methoxyethyl)-3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-amine (PubChem CID 134804920) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-amine.
| Compound Name | N-(2-methoxyethyl)-3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 134804920 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(2-methoxyethyl)-3-methyl-5-[3-(trifluoromethyl)phenyl]-[1,2]oxazolo[4,5-b]pyridin-7-amine |
| SMILES | COCCNc1cc(-c2cccc(C(F)(F)F)c2)nc2c(C)noc12 |
| InChI | InChI=1S/C17H16F3N3O2/c1-10-15-16(25-23-10)14(21-6-7-24-2)9-13(22-15)11-4-3-5-12(8-11)17(18,19)20/h3-5,8-9H,6-7H2,1-2H3,(H,21,22) |
| InChIKey | FUMGJGDOZGHZOH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|