C22H23N3O2 — CID 134806491
4-[[(4aS,9aS)-3-oxo-4-phenyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]benzonitrile (PubChem CID 134806491) has the molecular formula C22H23N3O2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-[[(4aS,9aS)-3-oxo-4-phenyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]benzonitrile.
| Compound Name | 4-[[(4aS,9aS)-3-oxo-4-phenyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 134806491 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 4-[[(4aS,9aS)-3-oxo-4-phenyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CC[C@@H]3OCC(=O)N(c4ccccc4)[C@H]3CC2)cc1 |
| InChI | InChI=1S/C22H23N3O2/c23-14-17-6-8-18(9-7-17)15-24-12-10-20-21(11-13-24)27-16-22(26)25(20)19-4-2-1-3-5-19/h1-9,20-21H,10-13,15-16H2/t20-,21-/m0/s1 |
| InChIKey | QLVKZJCMTSYOAH-SFTDATJTSA-N |
| XLogP | 2.95 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |