C22H27N3O2 — CID 134806513
(4aS,9aS)-7-benzyl-4-(2-pyridin-3-ylethyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one (PubChem CID 134806513) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (4aS,9aS)-7-benzyl-4-(2-pyridin-3-ylethyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one.
| Compound Name | (4aS,9aS)-7-benzyl-4-(2-pyridin-3-ylethyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
|---|---|
| PubChem CID | 134806513 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (4aS,9aS)-7-benzyl-4-(2-pyridin-3-ylethyl)-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
| SMILES | O=C1CO[C@H]2CCN(Cc3ccccc3)CC[C@@H]2N1CCc1cccnc1 |
| InChI | InChI=1S/C22H27N3O2/c26-22-17-27-21-10-13-24(16-19-5-2-1-3-6-19)12-9-20(21)25(22)14-8-18-7-4-11-23-15-18/h1-7,11,15,20-21H,8-10,12-14,16-17H2/t20-,21-/m0/s1 |
| InChIKey | NOZKCPYYGFPMLI-SFTDATJTSA-N |
| XLogP | 2.52 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |