C23H29N3O3 — CID 171689053
(6R,10R)-5-methyl-8-(pyridin-3-ylmethyl)-2,11-dioxa-5,8-diazatricyclo[14.4.0.06,10]icosa-1(20),16,18-trien-4-one (PubChem CID 171689053) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is (6R,10R)-5-methyl-8-(pyridin-3-ylmethyl)-2,11-dioxa-5,8-diazatricyclo[14.4.0.06,10]icosa-1(20),16,18-trien-4-one.
| Compound Name | (6R,10R)-5-methyl-8-(pyridin-3-ylmethyl)-2,11-dioxa-5,8-diazatricyclo[14.4.0.06,10]icosa-1(20),16,18-trien-4-one |
|---|---|
| PubChem CID | 171689053 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (6R,10R)-5-methyl-8-(pyridin-3-ylmethyl)-2,11-dioxa-5,8-diazatricyclo[14.4.0.06,10]icosa-1(20),16,18-trien-4-one |
| SMILES | CN1C(=O)COc2ccccc2CCCCO[C@@H]2CN(Cc3cccnc3)C[C@H]21 |
| InChI | InChI=1S/C23H29N3O3/c1-25-20-15-26(14-18-7-6-11-24-13-18)16-22(20)28-12-5-4-9-19-8-2-3-10-21(19)29-17-23(25)27/h2-3,6-8,10-11,13,20,22H,4-5,9,12,14-17H2,1H3/t20-,22-/m1/s1 |
| InChIKey | XOHWSJQPOHJIIK-IFMALSPDSA-N |
| XLogP | 2.52 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |