C17H23N5O — CID 155877501
(4aS,7aS)-6-[(3-methylimidazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 155877501) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is (4aS,7aS)-6-[(3-methylimidazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-6-[(3-methylimidazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 155877501 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (4aS,7aS)-6-[(3-methylimidazol-4-yl)methyl]-4-(pyridin-3-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | Cn1cncc1CN1C[C@@H]2OCCN(Cc3cccnc3)[C@H]2C1 |
| InChI | InChI=1S/C17H23N5O/c1-20-13-19-8-15(20)10-21-11-16-17(12-21)23-6-5-22(16)9-14-3-2-4-18-7-14/h2-4,7-8,13,16-17H,5-6,9-12H2,1H3/t16-,17-/m0/s1 |
| InChIKey | XRSUZJAVZWWKJG-IRXDYDNUSA-N |
| XLogP | 0.90 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |