C24H29ClN2O3 — CID 171700657
(6R,10R)-8-[(4-chlorophenyl)methyl]-5-methyl-2,11-dioxa-5,8-diazatricyclo[14.4.0.06,10]icosa-1(20),16,18-trien-4-one (PubChem CID 171700657) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is (6R,10R)-8-[(4-chlorophenyl)methyl]-5-methyl-2,11-dioxa-5,8-diazatricyclo[14.4.0.06,10]icosa-1(20),16,18-trien-4-one.
| Compound Name | (6R,10R)-8-[(4-chlorophenyl)methyl]-5-methyl-2,11-dioxa-5,8-diazatricyclo[14.4.0.06,10]icosa-1(20),16,18-trien-4-one |
|---|---|
| PubChem CID | 171700657 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (6R,10R)-8-[(4-chlorophenyl)methyl]-5-methyl-2,11-dioxa-5,8-diazatricyclo[14.4.0.06,10]icosa-1(20),16,18-trien-4-one |
| SMILES | CN1C(=O)COc2ccccc2CCCCO[C@@H]2CN(Cc3ccc(Cl)cc3)C[C@H]21 |
| InChI | InChI=1S/C24H29ClN2O3/c1-26-21-15-27(14-18-9-11-20(25)12-10-18)16-23(21)29-13-5-4-7-19-6-2-3-8-22(19)30-17-24(26)28/h2-3,6,8-12,21,23H,4-5,7,13-17H2,1H3/t21-,23-/m1/s1 |
| InChIKey | PYLLSRHKCHQLTP-FYYLOGMGSA-N |
| XLogP | 3.78 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |