C24H29ClN2O2 — CID 155987377
(6R,11S)-9-[(3-chlorophenyl)methyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one (PubChem CID 155987377) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is (6R,11S)-9-[(3-chlorophenyl)methyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one.
| Compound Name | (6R,11S)-9-[(3-chlorophenyl)methyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one |
|---|---|
| PubChem CID | 155987377 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (6R,11S)-9-[(3-chlorophenyl)methyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one |
| SMILES | O=C1COc2ccccc2CCCC[C@H]2CN(Cc3cccc(Cl)c3)CC[C@H]2N1 |
| InChI | InChI=1S/C24H29ClN2O2/c25-21-10-5-6-18(14-21)15-27-13-12-22-20(16-27)9-2-1-7-19-8-3-4-11-23(19)29-17-24(28)26-22/h3-6,8,10-11,14,20,22H,1-2,7,9,12-13,15-17H2,(H,26,28)/t20-,22+/m0/s1 |
| InChIKey | GKOSPUNVKLDSLT-RBBKRZOGSA-N |
| XLogP | 4.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |