C21H27N3O2S — CID 155987362
(6R,11S)-9-(1,3-thiazol-5-ylmethyl)-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one (PubChem CID 155987362) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is (6R,11S)-9-(1,3-thiazol-5-ylmethyl)-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one.
| Compound Name | (6R,11S)-9-(1,3-thiazol-5-ylmethyl)-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one |
|---|---|
| PubChem CID | 155987362 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (6R,11S)-9-(1,3-thiazol-5-ylmethyl)-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one |
| SMILES | O=C1COc2ccccc2CCCC[C@H]2CN(Cc3cncs3)CC[C@H]2N1 |
| InChI | InChI=1S/C21H27N3O2S/c25-21-14-26-20-8-4-3-6-16(20)5-1-2-7-17-12-24(10-9-19(17)23-21)13-18-11-22-15-27-18/h3-4,6,8,11,15,17,19H,1-2,5,7,9-10,12-14H2,(H,23,25)/t17-,19+/m0/s1 |
| InChIKey | GHDXJMLUKYTWPM-PKOBYXMFSA-N |
| XLogP | 3.26 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |