C22H30N4O2 — CID 155987356
(6R,11S)-9-[(3-methylimidazol-4-yl)methyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one (PubChem CID 155987356) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is (6R,11S)-9-[(3-methylimidazol-4-yl)methyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one.
| Compound Name | (6R,11S)-9-[(3-methylimidazol-4-yl)methyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one |
|---|---|
| PubChem CID | 155987356 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (6R,11S)-9-[(3-methylimidazol-4-yl)methyl]-2-oxa-5,9-diazatricyclo[14.4.0.06,11]icosa-1(20),16,18-trien-4-one |
| SMILES | Cn1cncc1CN1CC[C@H]2NC(=O)COc3ccccc3CCCC[C@H]2C1 |
| InChI | InChI=1S/C22H30N4O2/c1-25-16-23-12-19(25)14-26-11-10-20-18(13-26)8-3-2-6-17-7-4-5-9-21(17)28-15-22(27)24-20/h4-5,7,9,12,16,18,20H,2-3,6,8,10-11,13-15H2,1H3,(H,24,27)/t18-,20+/m0/s1 |
| InChIKey | AJJTXOSREGJTIX-AZUAARDMSA-N |
| XLogP | 2.53 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |