C24H36N6O3 — CID 110063328
(1R,9E,12S)-1'-acetyl-14-[(3-methylimidazol-4-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione (PubChem CID 110063328) has the molecular formula C24H36N6O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (1R,9E,12S)-1'-acetyl-14-[(3-methylimidazol-4-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione.
| Compound Name | (1R,9E,12S)-1'-acetyl-14-[(3-methylimidazol-4-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione |
|---|---|
| PubChem CID | 110063328 |
| Molecular Formula | C24H36N6O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | (1R,9E,12S)-1'-acetyl-14-[(3-methylimidazol-4-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione |
| SMILES | CC(=O)N1CCC2(C/C=C/C[C@H]3CN(Cc4cncn4C)CC[C@H]3NC(=O)CNC2=O)CC1 |
| InChI | InChI=1S/C24H36N6O3/c1-18(31)30-11-8-24(9-12-30)7-4-3-5-19-15-29(16-20-13-25-17-28(20)2)10-6-21(19)27-22(32)14-26-23(24)33/h3-4,13,17,19,21H,5-12,14-16H2,1-2H3,(H,26,33)(H,27,32)/b4-3+/t19-,21+/m0/s1 |
| InChIKey | RHPFOWNYFRAOFL-AWJROHARSA-N |
| XLogP | 0.82 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|