C25H40N6O3 — CID 133072654
(1R,12S)-14-acetyl-1'-[(1,4-dimethylpyrazol-5-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadecane-7,4'-piperidine]-3,6-dione (PubChem CID 133072654) has the molecular formula C25H40N6O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is (1R,12S)-14-acetyl-1'-[(1,4-dimethylpyrazol-5-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadecane-7,4'-piperidine]-3,6-dione.
| Compound Name | (1R,12S)-14-acetyl-1'-[(1,4-dimethylpyrazol-5-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadecane-7,4'-piperidine]-3,6-dione |
|---|---|
| PubChem CID | 133072654 |
| Molecular Formula | C25H40N6O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | (1R,12S)-14-acetyl-1'-[(1,4-dimethylpyrazol-5-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadecane-7,4'-piperidine]-3,6-dione |
| SMILES | CC(=O)N1CC[C@H]2NC(=O)CNC(=O)C3(CCCC[C@H]2C1)CCN(Cc1c(C)cnn1C)CC3 |
| InChI | InChI=1S/C25H40N6O3/c1-18-14-27-29(3)22(18)17-30-12-9-25(10-13-30)8-5-4-6-20-16-31(19(2)32)11-7-21(20)28-23(33)15-26-24(25)34/h14,20-21H,4-13,15-17H2,1-3H3,(H,26,34)(H,28,33)/t20-,21+/m0/s1 |
| InChIKey | FMMUCLPJXOQYLT-LEWJYISDSA-N |
| XLogP | 1.35 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |