C24H37N5O3S — CID 110063373
(1R,12S)-14-acetyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadecane-7,4'-piperidine]-3,6-dione (PubChem CID 110063373) has the molecular formula C24H37N5O3S and a molecular weight of 475.66 g/mol. Its IUPAC name is (1R,12S)-14-acetyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadecane-7,4'-piperidine]-3,6-dione.
| Compound Name | (1R,12S)-14-acetyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadecane-7,4'-piperidine]-3,6-dione |
|---|---|
| PubChem CID | 110063373 |
| Molecular Formula | C24H37N5O3S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | (1R,12S)-14-acetyl-1'-[(4-methyl-1,3-thiazol-5-yl)methyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadecane-7,4'-piperidine]-3,6-dione |
| SMILES | CC(=O)N1CC[C@H]2NC(=O)CNC(=O)C3(CCCC[C@H]2C1)CCN(Cc1scnc1C)CC3 |
| InChI | InChI=1S/C24H37N5O3S/c1-17-21(33-16-26-17)15-28-11-8-24(9-12-28)7-4-3-5-19-14-29(18(2)30)10-6-20(19)27-22(31)13-25-23(24)32/h16,19-20H,3-15H2,1-2H3,(H,25,32)(H,27,31)/t19-,20+/m0/s1 |
| InChIKey | XKCSAGBFRYWIKC-VQTJNVASSA-N |
| XLogP | 2.08 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |