C24H32ClN3O3 — CID 155984561
(1S,9E,12R)-1'-[(2-chlorophenyl)methyl]spiro[14-oxa-2,5-diazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione (PubChem CID 155984561) has the molecular formula C24H32ClN3O3 and a molecular weight of 445.99 g/mol. Its IUPAC name is (1S,9E,12R)-1'-[(2-chlorophenyl)methyl]spiro[14-oxa-2,5-diazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione.
| Compound Name | (1S,9E,12R)-1'-[(2-chlorophenyl)methyl]spiro[14-oxa-2,5-diazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione |
|---|---|
| PubChem CID | 155984561 |
| Molecular Formula | C24H32ClN3O3 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (1S,9E,12R)-1'-[(2-chlorophenyl)methyl]spiro[14-oxa-2,5-diazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione |
| SMILES | O=C1CNC(=O)C2(C/C=C/C[C@H]3COCC[C@@H]3N1)CCN(Cc1ccccc1Cl)CC2 |
| InChI | InChI=1S/C24H32ClN3O3/c25-20-7-2-1-5-18(20)16-28-12-10-24(11-13-28)9-4-3-6-19-17-31-14-8-21(19)27-22(29)15-26-23(24)30/h1-5,7,19,21H,6,8-17H2,(H,26,30)(H,27,29)/b4-3+/t19-,21-/m0/s1 |
| InChIKey | DAPYXHALCIPQIC-CKXGLSNISA-N |
| XLogP | 2.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|