C38H50N4O4 — CID 155989266
(1R,4R,9E,12S)-4-benzyl-14-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione (PubChem CID 155989266) has the molecular formula C38H50N4O4 and a molecular weight of 626.84 g/mol. Its IUPAC name is (1R,4R,9E,12S)-4-benzyl-14-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione.
| Compound Name | (1R,4R,9E,12S)-4-benzyl-14-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
|---|---|
| PubChem CID | 155989266 |
| Molecular Formula | C38H50N4O4 |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.38 |
| IUPAC Name | (1R,4R,9E,12S)-4-benzyl-14-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
| SMILES | O=C1N[C@@H]2CCN(CC(=O)N3CCC(Cc4ccccc4)CC3)C[C@@H]2C/C=C/CC2(CCOCC2)C(=O)N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C38H50N4O4/c43-35(42-21-14-31(15-22-42)25-29-9-3-1-4-10-29)28-41-20-16-33-32(27-41)13-7-8-17-38(18-23-46-24-19-38)37(45)40-34(36(44)39-33)26-30-11-5-2-6-12-30/h1-12,31-34H,13-28H2,(H,39,44)(H,40,45)/b8-7+/t32-,33+,34+/m0/s1 |
| InChIKey | DQEBWUDLVZKWHA-IPCQSRLGSA-N |
| XLogP | 4.15 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|