C33H41FN4O4 — CID 133065888
2-[(1R,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 133065888) has the molecular formula C33H41FN4O4 and a molecular weight of 576.71 g/mol. Its IUPAC name is 2-[(1R,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[(1R,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 133065888 |
| Molecular Formula | C33H41FN4O4 |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 2-[(1R,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CN1CC[C@H]2NC(=O)[C@@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@@H]2C1)CCOCC3)NCc1cccc(F)c1 |
| InChI | InChI=1S/C33H41FN4O4/c34-27-11-6-9-25(19-27)21-35-30(39)23-38-16-12-28-26(22-38)10-4-5-13-33(14-17-42-18-15-33)32(41)37-29(31(40)36-28)20-24-7-2-1-3-8-24/h1-9,11,19,26,28-29H,10,12-18,20-23H2,(H,35,39)(H,36,40)(H,37,41)/b5-4+/t26-,28-,29-/m1/s1 |
| InChIKey | FYXSMWUCMFLGFM-AZGNZKEWSA-N |
| XLogP | 3.12 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|