C33H38ClF3N4O4 — CID 110074126
2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 110074126) has the molecular formula C33H38ClF3N4O4 and a molecular weight of 647.14 g/mol. Its IUPAC name is 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 110074126 |
| Molecular Formula | C33H38ClF3N4O4 |
| Molecular Weight | 647.14 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CC[C@H]2NC(=O)[C@@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@H]2C1)CCOCC3)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H38ClF3N4O4/c34-26-10-9-24(19-25(26)33(35,36)37)38-29(42)21-41-15-11-27-23(20-41)8-4-5-12-32(13-16-45-17-14-32)31(44)40-28(30(43)39-27)18-22-6-2-1-3-7-22/h1-7,9-10,19,23,27-28H,8,11-18,20-21H2,(H,38,42)(H,39,43)(H,40,44)/b5-4+/t23-,27+,28+/m0/s1 |
| InChIKey | FEWMODHFKFYHKZ-IAXUYCLCSA-N |
| XLogP | 4.98 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.14 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|