C33H39F3N4O4 — CID 110074065
2-[(1S,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 110074065) has the molecular formula C33H39F3N4O4 and a molecular weight of 612.69 g/mol. Its IUPAC name is 2-[(1S,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(1S,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 110074065 |
| Molecular Formula | C33H39F3N4O4 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | 2-[(1S,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CC[C@@H]2NC(=O)[C@@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@H]2C1)CCOCC3)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H39F3N4O4/c34-33(35,36)25-10-6-11-26(20-25)37-29(41)22-40-16-12-27-24(21-40)9-4-5-13-32(14-17-44-18-15-32)31(43)39-28(30(42)38-27)19-23-7-2-1-3-8-23/h1-8,10-11,20,24,27-28H,9,12-19,21-22H2,(H,37,41)(H,38,42)(H,39,43)/b5-4+/t24-,27-,28+/m0/s1 |
| InChIKey | BUEOLBUFMXAQPP-UBTDQANZSA-N |
| XLogP | 4.32 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|