C34H44N4O5 — CID 110074001
2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 110074001) has the molecular formula C34H44N4O5 and a molecular weight of 588.75 g/mol. Its IUPAC name is 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 110074001 |
| Molecular Formula | C34H44N4O5 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2CC[C@H]3NC(=O)[C@@H](Cc4ccccc4)NC(=O)C4(C/C=C/C[C@H]3C2)CCOCC4)cc1 |
| InChI | InChI=1S/C34H44N4O5/c1-2-43-28-13-11-27(12-14-28)35-31(39)24-38-19-15-29-26(23-38)10-6-7-16-34(17-20-42-21-18-34)33(41)37-30(32(40)36-29)22-25-8-4-3-5-9-25/h3-9,11-14,26,29-30H,2,10,15-24H2,1H3,(H,35,39)(H,36,40)(H,37,41)/b7-6+/t26-,29+,30+/m0/s1 |
| InChIKey | VXTGZTOQEMCGPK-YFXVNVFXSA-N |
| XLogP | 3.70 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|