C38H44N4O5 — CID 110074101
2-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 110074101) has the molecular formula C38H44N4O5 and a molecular weight of 636.79 g/mol. Its IUPAC name is 2-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 110074101 |
| Molecular Formula | C38H44N4O5 |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | 2-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(CN1CC[C@H]2NC(=O)[C@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@H]2C1)CCOCC3)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C38H44N4O5/c43-35(39-30-14-16-32(17-15-30)47-31-12-5-2-6-13-31)27-42-22-18-33-29(26-42)11-7-8-19-38(20-23-46-24-21-38)37(45)41-34(36(44)40-33)25-28-9-3-1-4-10-28/h1-10,12-17,29,33-34H,11,18-27H2,(H,39,43)(H,40,44)(H,41,45)/b8-7+/t29-,33+,34-/m0/s1 |
| InChIKey | XCLNTWKCJWZRMD-LLNDTAKCSA-N |
| XLogP | 5.10 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|