C33H40F2N4O5 — CID 171147630
2-[(1R,4R,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 171147630) has the molecular formula C33H40F2N4O5 and a molecular weight of 610.70 g/mol. Its IUPAC name is 2-[(1R,4R,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(1R,4R,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 171147630 |
| Molecular Formula | C33H40F2N4O5 |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | 2-[(1R,4R,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1CC[C@H]2NC(=O)[C@@H](Cc3ccccc3)NC(=O)C3(CC=CC[C@H]2C1)CCOCC3)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C33H40F2N4O5/c34-32(35)44-26-11-9-25(10-12-26)36-29(40)22-39-17-13-27-24(21-39)8-4-5-14-33(15-18-43-19-16-33)31(42)38-28(30(41)37-27)20-23-6-2-1-3-7-23/h1-7,9-12,24,27-28,32H,8,13-22H2,(H,36,40)(H,37,41)(H,38,42)/t24-,27+,28+/m0/s1 |
| InChIKey | VBHZSUGDQISSQD-HNPKZYAISA-N |
| XLogP | 3.91 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|