C34H42N6O4 — CID 133066449
2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(2-methyl-3H-benzimidazol-5-yl)acetamide (PubChem CID 133066449) has the molecular formula C34H42N6O4 and a molecular weight of 598.75 g/mol. Its IUPAC name is 2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(2-methyl-3H-benzimidazol-5-yl)acetamide.
| Compound Name | 2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(2-methyl-3H-benzimidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 133066449 |
| Molecular Formula | C34H42N6O4 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-(2-methyl-3H-benzimidazol-5-yl)acetamide |
| SMILES | Cc1nc2ccc(NC(=O)CN3CC[C@@H]4NC(=O)[C@@H](Cc5ccccc5)NC(=O)C5(C/C=C/C[C@@H]4C3)CCOCC5)cc2[nH]1 |
| InChI | InChI=1S/C34H42N6O4/c1-23-35-28-11-10-26(20-29(28)36-23)37-31(41)22-40-16-12-27-25(21-40)9-5-6-13-34(14-17-44-18-15-34)33(43)39-30(32(42)38-27)19-24-7-3-2-4-8-24/h2-8,10-11,20,25,27,30H,9,12-19,21-22H2,1H3,(H,35,36)(H,37,41)(H,38,42)(H,39,43)/b6-5+/t25-,27+,30-/m1/s1 |
| InChIKey | ZXTRKMVNAUEULO-QPWBISMESA-N |
| XLogP | 3.49 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|