C34H39F3N6O4 — CID 110074132
2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide (PubChem CID 110074132) has the molecular formula C34H39F3N6O4 and a molecular weight of 652.72 g/mol. Its IUPAC name is 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide.
| Compound Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide |
|---|---|
| PubChem CID | 110074132 |
| Molecular Formula | C34H39F3N6O4 |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide |
| SMILES | O=C(CN1CC[C@H]2NC(=O)[C@@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@H]2C1)CCOCC3)Nc1ccc2nc(C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C34H39F3N6O4/c35-34(36,37)31-40-26-10-9-24(19-27(26)41-31)38-29(44)21-43-15-11-25-23(20-43)8-4-5-12-33(13-16-47-17-14-33)32(46)42-28(30(45)39-25)18-22-6-2-1-3-7-22/h1-7,9-10,19,23,25,28H,8,11-18,20-21H2,(H,38,44)(H,39,45)(H,40,41)(H,42,46)/b5-4+/t23-,25+,28+/m0/s1 |
| InChIKey | MOMBBKZINWYCSB-JFIAGAGBSA-N |
| XLogP | 4.20 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|