C28H40N4O4 — CID 110073869
2-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N,N-dimethylacetamide (PubChem CID 110073869) has the molecular formula C28H40N4O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110073869 |
| Molecular Formula | C28H40N4O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 2-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CC[C@H]2NC(=O)[C@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@H]2C1)CCOCC3 |
| InChI | InChI=1S/C28H40N4O4/c1-31(2)25(33)20-32-15-11-23-22(19-32)10-6-7-12-28(13-16-36-17-14-28)27(35)30-24(26(34)29-23)18-21-8-4-3-5-9-21/h3-9,22-24H,10-20H2,1-2H3,(H,29,34)(H,30,35)/b7-6+/t22-,23+,24-/m0/s1 |
| InChIKey | MUYPTLBYWJHLLP-PGLLBFKCSA-N |
| XLogP | 1.76 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|