C35H45N5O6 — CID 171147670
(1S,4R,12R)-4-benzyl-14-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione (PubChem CID 171147670) has the molecular formula C35H45N5O6 and a molecular weight of 631.77 g/mol. Its IUPAC name is (1S,4R,12R)-4-benzyl-14-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione.
| Compound Name | (1S,4R,12R)-4-benzyl-14-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
|---|---|
| PubChem CID | 171147670 |
| Molecular Formula | C35H45N5O6 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | (1S,4R,12R)-4-benzyl-14-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
| SMILES | O=C1N[C@H]2CCN(CC(=O)N3CCN(C(=O)c4ccco4)CC3)C[C@H]2CC=CCC2(CCOCC2)C(=O)N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C35H45N5O6/c41-31(39-16-18-40(19-17-39)33(43)30-10-6-20-46-30)25-38-15-11-28-27(24-38)9-4-5-12-35(13-21-45-22-14-35)34(44)37-29(32(42)36-28)23-26-7-2-1-3-8-26/h1-8,10,20,27-29H,9,11-19,21-25H2,(H,36,42)(H,37,44)/t27-,28+,29-/m1/s1 |
| InChIKey | GETRMYOPHRWPOA-SSBOKUKZSA-N |
| XLogP | 2.24 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|