C37H49N5O5 — CID 171147645
(1R,4R,12S)-4-benzyl-14-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione (PubChem CID 171147645) has the molecular formula C37H49N5O5 and a molecular weight of 643.83 g/mol. Its IUPAC name is (1R,4R,12S)-4-benzyl-14-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione.
| Compound Name | (1R,4R,12S)-4-benzyl-14-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
|---|---|
| PubChem CID | 171147645 |
| Molecular Formula | C37H49N5O5 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.37 |
| IUPAC Name | (1R,4R,12S)-4-benzyl-14-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
| SMILES | COc1ccccc1N1CCN(C(=O)CN2CC[C@H]3NC(=O)[C@@H](Cc4ccccc4)NC(=O)C4(CC=CC[C@H]3C2)CCOCC4)CC1 |
| InChI | InChI=1S/C37H49N5O5/c1-46-33-13-6-5-12-32(33)41-19-21-42(22-20-41)34(43)27-40-18-14-30-29(26-40)11-7-8-15-37(16-23-47-24-17-37)36(45)39-31(35(44)38-30)25-28-9-3-2-4-10-28/h2-10,12-13,29-31H,11,14-27H2,1H3,(H,38,44)(H,39,45)/t29-,30+,31+/m0/s1 |
| InChIKey | MKDJNLNELDFJEB-OJDZSJEKSA-N |
| XLogP | 3.02 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|