C33H48N4O4 — CID 110073917
2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-cyclohexyl-N-methylacetamide (PubChem CID 110073917) has the molecular formula C33H48N4O4 and a molecular weight of 564.77 g/mol. Its IUPAC name is 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 110073917 |
| Molecular Formula | C33H48N4O4 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | 2-[(1R,4R,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-cyclohexyl-N-methylacetamide |
| SMILES | CN(C(=O)CN1CC[C@H]2NC(=O)[C@@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@H]2C1)CCOCC3)C1CCCCC1 |
| InChI | InChI=1S/C33H48N4O4/c1-36(27-13-6-3-7-14-27)30(38)24-37-19-15-28-26(23-37)12-8-9-16-33(17-20-41-21-18-33)32(40)35-29(31(39)34-28)22-25-10-4-2-5-11-25/h2,4-5,8-11,26-29H,3,6-7,12-24H2,1H3,(H,34,39)(H,35,40)/b9-8+/t26-,28+,29+/m0/s1 |
| InChIKey | BQCGRZMBKSLOQT-BAWOXDGESA-N |
| XLogP | 3.46 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|