C31H44N4O4 — CID 110073885
(1S,4R,9E,12R)-4-benzyl-14-(2-oxo-2-piperidin-1-ylethyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione (PubChem CID 110073885) has the molecular formula C31H44N4O4 and a molecular weight of 536.72 g/mol. Its IUPAC name is (1S,4R,9E,12R)-4-benzyl-14-(2-oxo-2-piperidin-1-ylethyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione.
| Compound Name | (1S,4R,9E,12R)-4-benzyl-14-(2-oxo-2-piperidin-1-ylethyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
|---|---|
| PubChem CID | 110073885 |
| Molecular Formula | C31H44N4O4 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | (1S,4R,9E,12R)-4-benzyl-14-(2-oxo-2-piperidin-1-ylethyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
| SMILES | O=C1N[C@H]2CCN(CC(=O)N3CCCCC3)C[C@H]2C/C=C/CC2(CCOCC2)C(=O)N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C31H44N4O4/c36-28(35-16-7-2-8-17-35)23-34-18-12-26-25(22-34)11-5-6-13-31(14-19-39-20-15-31)30(38)33-27(29(37)32-26)21-24-9-3-1-4-10-24/h1,3-6,9-10,25-27H,2,7-8,11-23H2,(H,32,37)(H,33,38)/b6-5+/t25-,26+,27-/m1/s1 |
| InChIKey | GDWRQWZLMFACHV-RJYDUPRLSA-N |
| XLogP | 2.68 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|