C29H37N5O4 — CID 155990016
(1S,4R,9E,12R)-4-benzyl-14-(2-pyrazol-1-ylacetyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione (PubChem CID 155990016) has the molecular formula C29H37N5O4 and a molecular weight of 519.65 g/mol. Its IUPAC name is (1S,4R,9E,12R)-4-benzyl-14-(2-pyrazol-1-ylacetyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione.
| Compound Name | (1S,4R,9E,12R)-4-benzyl-14-(2-pyrazol-1-ylacetyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
|---|---|
| PubChem CID | 155990016 |
| Molecular Formula | C29H37N5O4 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | (1S,4R,9E,12R)-4-benzyl-14-(2-pyrazol-1-ylacetyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
| SMILES | O=C1N[C@H]2CCN(C(=O)Cn3cccn3)C[C@H]2C/C=C/CC2(CCOCC2)C(=O)N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H37N5O4/c35-26(21-34-15-6-14-30-34)33-16-10-24-23(20-33)9-4-5-11-29(12-17-38-18-13-29)28(37)32-25(27(36)31-24)19-22-7-2-1-3-8-22/h1-8,14-15,23-25H,9-13,16-21H2,(H,31,36)(H,32,37)/b5-4+/t23-,24+,25-/m1/s1 |
| InChIKey | VXNFMLMUFQXJFI-USIXGNMYSA-N |
| XLogP | 2.09 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|