C28H39N5O5 — CID 110063548
(3S)-3-amino-4-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-4-oxobutanamide (PubChem CID 110063548) has the molecular formula C28H39N5O5 and a molecular weight of 525.65 g/mol. Its IUPAC name is (3S)-3-amino-4-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-4-oxobutanamide.
| Compound Name | (3S)-3-amino-4-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110063548 |
| Molecular Formula | C28H39N5O5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | (3S)-3-amino-4-[(1R,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-4-oxobutanamide |
| SMILES | NC(=O)C[C@H](N)C(=O)N1CC[C@H]2NC(=O)[C@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@H]2C1)CCOCC3 |
| InChI | InChI=1S/C28H39N5O5/c29-21(17-24(30)34)26(36)33-13-9-22-20(18-33)8-4-5-10-28(11-14-38-15-12-28)27(37)32-23(25(35)31-22)16-19-6-2-1-3-7-19/h1-7,20-23H,8-18,29H2,(H2,30,34)(H,31,35)(H,32,37)/b5-4+/t20-,21-,22+,23-/m0/s1 |
| InChIKey | HYEMABBNTKEFBI-WIPQRNIKSA-N |
| XLogP | 0.40 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|