C29H36N4O5 — CID 155994907
(1S,4R,9E,12R)-4-benzyl-14-(5-methyl-1,2-oxazole-4-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione (PubChem CID 155994907) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is (1S,4R,9E,12R)-4-benzyl-14-(5-methyl-1,2-oxazole-4-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione.
| Compound Name | (1S,4R,9E,12R)-4-benzyl-14-(5-methyl-1,2-oxazole-4-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
|---|---|
| PubChem CID | 155994907 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | (1S,4R,9E,12R)-4-benzyl-14-(5-methyl-1,2-oxazole-4-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
| SMILES | Cc1oncc1C(=O)N1CC[C@@H]2NC(=O)[C@@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@@H]2C1)CCOCC3 |
| InChI | InChI=1S/C29H36N4O5/c1-20-23(18-30-38-20)27(35)33-14-10-24-22(19-33)9-5-6-11-29(12-15-37-16-13-29)28(36)32-25(26(34)31-24)17-21-7-3-2-4-8-21/h2-8,18,22,24-25H,9-17,19H2,1H3,(H,31,34)(H,32,36)/b6-5+/t22-,24+,25-/m1/s1 |
| InChIKey | JSMUPZOYXYUCQA-VMRXUYAJSA-N |
| XLogP | 2.80 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|