C30H37N5O5 — CID 155989452
(1S,4S,9E,12R)-4-benzyl-14-(6-methyl-2-oxo-1H-pyrimidine-4-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione (PubChem CID 155989452) has the molecular formula C30H37N5O5 and a molecular weight of 547.66 g/mol. Its IUPAC name is (1S,4S,9E,12R)-4-benzyl-14-(6-methyl-2-oxo-1H-pyrimidine-4-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione.
| Compound Name | (1S,4S,9E,12R)-4-benzyl-14-(6-methyl-2-oxo-1H-pyrimidine-4-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
|---|---|
| PubChem CID | 155989452 |
| Molecular Formula | C30H37N5O5 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | (1S,4S,9E,12R)-4-benzyl-14-(6-methyl-2-oxo-1H-pyrimidine-4-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
| SMILES | Cc1cc(C(=O)N2CC[C@@H]3NC(=O)[C@H](Cc4ccccc4)NC(=O)C4(C/C=C/C[C@@H]3C2)CCOCC4)nc(=O)[nH]1 |
| InChI | InChI=1S/C30H37N5O5/c1-20-17-25(34-29(39)31-20)27(37)35-14-10-23-22(19-35)9-5-6-11-30(12-15-40-16-13-30)28(38)33-24(26(36)32-23)18-21-7-3-2-4-8-21/h2-8,17,22-24H,9-16,18-19H2,1H3,(H,32,36)(H,33,38)(H,31,34,39)/b6-5+/t22-,23+,24+/m1/s1 |
| InChIKey | XRQDGFGQVYSLPT-LGLQVUKTSA-N |
| XLogP | 1.90 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|