C31H42N4O5 — CID 110063558
(1S,4S,9E,12R)-14-[(2R)-1-acetylpyrrolidine-2-carbonyl]-4-benzylspiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione (PubChem CID 110063558) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is (1S,4S,9E,12R)-14-[(2R)-1-acetylpyrrolidine-2-carbonyl]-4-benzylspiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione.
| Compound Name | (1S,4S,9E,12R)-14-[(2R)-1-acetylpyrrolidine-2-carbonyl]-4-benzylspiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
|---|---|
| PubChem CID | 110063558 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | (1S,4S,9E,12R)-14-[(2R)-1-acetylpyrrolidine-2-carbonyl]-4-benzylspiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
| SMILES | CC(=O)N1CCC[C@@H]1C(=O)N1CC[C@@H]2NC(=O)[C@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@@H]2C1)CCOCC3 |
| InChI | InChI=1S/C31H42N4O5/c1-22(36)35-16-7-11-27(35)29(38)34-17-12-25-24(21-34)10-5-6-13-31(14-18-40-19-15-31)30(39)33-26(28(37)32-25)20-23-8-3-2-4-9-23/h2-6,8-9,24-27H,7,10-21H2,1H3,(H,32,37)(H,33,39)/b6-5+/t24-,25+,26+,27-/m1/s1 |
| InChIKey | VVNUMTFUGBPYSV-PXRNMKTRSA-N |
| XLogP | 2.20 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|