C32H46N4O4 — CID 110073900
(1R,4R,9E,12S)-14-[2-(azepan-1-yl)-2-oxoethyl]-4-benzylspiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione (PubChem CID 110073900) has the molecular formula C32H46N4O4 and a molecular weight of 550.74 g/mol. Its IUPAC name is (1R,4R,9E,12S)-14-[2-(azepan-1-yl)-2-oxoethyl]-4-benzylspiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione.
| Compound Name | (1R,4R,9E,12S)-14-[2-(azepan-1-yl)-2-oxoethyl]-4-benzylspiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
|---|---|
| PubChem CID | 110073900 |
| Molecular Formula | C32H46N4O4 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | (1R,4R,9E,12S)-14-[2-(azepan-1-yl)-2-oxoethyl]-4-benzylspiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-3,6-dione |
| SMILES | O=C1N[C@@H]2CCN(CC(=O)N3CCCCCC3)C[C@@H]2C/C=C/CC2(CCOCC2)C(=O)N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C32H46N4O4/c37-29(36-17-8-1-2-9-18-36)24-35-19-13-27-26(23-35)12-6-7-14-32(15-20-40-21-16-32)31(39)34-28(30(38)33-27)22-25-10-4-3-5-11-25/h3-7,10-11,26-28H,1-2,8-9,12-24H2,(H,33,38)(H,34,39)/b7-6+/t26-,27+,28+/m0/s1 |
| InChIKey | VCBTYPPLLLWIES-XLOXDCOTSA-N |
| XLogP | 3.07 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|