C33H46N4O6 — CID 110074506
methyl 1-[2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]acetyl]piperidine-4-carboxylate (PubChem CID 110074506) has the molecular formula C33H46N4O6 and a molecular weight of 594.75 g/mol. Its IUPAC name is methyl 1-[2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 110074506 |
| Molecular Formula | C33H46N4O6 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | methyl 1-[2-[(1S,4R,9E,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CN2CC[C@@H]3NC(=O)[C@@H](Cc4ccccc4)NC(=O)C4(C/C=C/C[C@@H]3C2)CCOCC4)CC1 |
| InChI | InChI=1S/C33H46N4O6/c1-42-31(40)25-10-17-37(18-11-25)29(38)23-36-16-12-27-26(22-36)9-5-6-13-33(14-19-43-20-15-33)32(41)35-28(30(39)34-27)21-24-7-3-2-4-8-24/h2-8,25-28H,9-23H2,1H3,(H,34,39)(H,35,41)/b6-5+/t26-,27+,28-/m1/s1 |
| InChIKey | ICRHAHLGMFFRNP-XVIRUUMYSA-N |
| XLogP | 2.08 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|