C32H47N7O5 — CID 155984673
N-[(2R)-1-[(1S,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide (PubChem CID 155984673) has the molecular formula C32H47N7O5 and a molecular weight of 609.77 g/mol. Its IUPAC name is N-[(2R)-1-[(1S,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide.
| Compound Name | N-[(2R)-1-[(1S,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 155984673 |
| Molecular Formula | C32H47N7O5 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.36 |
| IUPAC Name | N-[(2R)-1-[(1S,4S,9E,12S)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](CCCN=C(N)N)C(=O)N1CC[C@@H]2NC(=O)[C@H](Cc3ccccc3)NC(=O)C3(C/C=C/C[C@H]2C1)CCOCC3 |
| InChI | InChI=1S/C32H47N7O5/c1-22(40)36-26(11-7-16-35-31(33)34)29(42)39-17-12-25-24(21-39)10-5-6-13-32(14-18-44-19-15-32)30(43)38-27(28(41)37-25)20-23-8-3-2-4-9-23/h2-6,8-9,24-27H,7,10-21H2,1H3,(H,36,40)(H,37,41)(H,38,43)(H4,33,34,35)/b6-5+/t24-,25-,26+,27-/m0/s1 |
| InChIKey | IYABPSPXACRXRN-CDTMJQMKSA-N |
| XLogP | 0.75 |
| TPSA | 181.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|