C36H43N5O5S — CID 171147000
2-[(1S,4R,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 171147000) has the molecular formula C36H43N5O5S and a molecular weight of 657.84 g/mol. Its IUPAC name is 2-[(1S,4R,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(1S,4R,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 171147000 |
| Molecular Formula | C36H43N5O5S |
| Molecular Weight | 657.84 g/mol |
| Exact Mass | 657.30 |
| IUPAC Name | 2-[(1S,4R,12R)-4-benzyl-3,6-dioxospiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-oxane]-14-yl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CN3CC[C@@H]4NC(=O)[C@@H](Cc5ccccc5)NC(=O)C5(CC=CC[C@@H]4C3)CCOCC5)n2)cc1 |
| InChI | InChI=1S/C36H43N5O5S/c1-45-28-12-10-26(11-13-28)31-24-47-35(39-31)40-32(42)23-41-18-14-29-27(22-41)9-5-6-15-36(16-19-46-20-17-36)34(44)38-30(33(43)37-29)21-25-7-3-2-4-8-25/h2-8,10-13,24,27,29-30H,9,14-23H2,1H3,(H,37,43)(H,38,44)(H,39,40,42)/t27-,29+,30-/m1/s1 |
| InChIKey | BDYPYXXFWLPXER-CCNCKIRNSA-N |
| XLogP | 4.44 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|