C25H35N5O5 — CID 133072442
(1R,9E,12S)-1'-acetyl-14-(3-ethyl-1,2-oxazole-5-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione (PubChem CID 133072442) has the molecular formula C25H35N5O5 and a molecular weight of 485.59 g/mol. Its IUPAC name is (1R,9E,12S)-1'-acetyl-14-(3-ethyl-1,2-oxazole-5-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione.
| Compound Name | (1R,9E,12S)-1'-acetyl-14-(3-ethyl-1,2-oxazole-5-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione |
|---|---|
| PubChem CID | 133072442 |
| Molecular Formula | C25H35N5O5 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | (1R,9E,12S)-1'-acetyl-14-(3-ethyl-1,2-oxazole-5-carbonyl)spiro[2,5,14-triazabicyclo[10.4.0]hexadec-9-ene-7,4'-piperidine]-3,6-dione |
| SMILES | CCc1cc(C(=O)N2CC[C@H]3NC(=O)CNC(=O)C4(C/C=C/C[C@H]3C2)CCN(C(C)=O)CC4)on1 |
| InChI | InChI=1S/C25H35N5O5/c1-3-19-14-21(35-28-19)23(33)30-11-7-20-18(16-30)6-4-5-8-25(24(34)26-15-22(32)27-20)9-12-29(13-10-25)17(2)31/h4-5,14,18,20H,3,6-13,15-16H2,1-2H3,(H,26,34)(H,27,32)/b5-4+/t18-,20+/m0/s1 |
| InChIKey | WEGKFCQUGQDERK-LJGXYGFNSA-N |
| XLogP | 1.28 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|